37942-07-7
| Name | 3,5-Bis(1,1-dimethylethyl)-2-hydroxy-benzaldehyde |
| CAS | 37942-07-7 |
| EINECS(EC#) | 629-676-0 |
| Molecular Formula | C15H22O2 |
| MDL Number | MFCD00191998 |
| Molecular Weight | 234.33 |
| MOL File | 37942-07-7.mol |
Chemical Properties
| Melting point | 59-61 °C(lit.) |
| Boiling point | 277.6±35.0 °C(Predicted) |
| density | 1.006±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO and methanol. |
| form | Solid |
| pka | 9.78±0.23(Predicted) |
| color | Off-White to Light Yellow |
| Sensitive | Air Sensitive |
| BRN | 1877810 |
| InChI | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(9-16)13(17)12(8-11)15(4,5)6/h7-9,17H,1-6H3 |
| InChIKey | RRIQVLZDOZPJTH-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O |
| CAS DataBase Reference | 37942-07-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |