
19715-19-6
| Name | 3,5-Bis-tert-butylsalicylic acid |
| CAS | 19715-19-6 |
| EINECS(EC#) | 243-246-6 |
| Molecular Formula | C15H22O3 |
| MDL Number | MFCD00059058 |
| Molecular Weight | 250.33 |
| MOL File | 19715-19-6.mol |
Chemical Properties
| Appearance | Off-white to beige powder |
| Melting point | 157-162 °C (lit.) |
| Boiling point | 335.6±42.0 °C(Predicted) |
| density | 1.070±0.06 g/cm3(Predicted) |
| Fp | 179 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 3.34±0.14(Predicted) |
| color | Off-white to beige |
| InChI | InChI=1S/C15H22O3/c1-14(2,3)9-7-10(13(17)18)12(16)11(8-9)15(4,5)6/h7-8,16H,1-6H3,(H,17,18) |
| InChIKey | ZWQBZEFLFSFEOS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O |
| CAS DataBase Reference | 19715-19-6(CAS DataBase Reference) |
| EPA Substance Registry System | 19715-19-6(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
