375-95-1
| Name | PERFLUORONONANOIC ACID |
| CAS | 375-95-1 |
| EINECS(EC#) | 206-801-3 |
| Molecular Formula | C9HF17O2 |
| MDL Number | MFCD00039605 |
| Molecular Weight | 464.08 |
| MOL File | 375-95-1.mol |
Chemical Properties
| Appearance | white crystalline powder |
| Melting point | 59-62 °C (lit.) |
| Boiling point | 218°C |
| density | 1.7397 (estimate) |
| Fp | 218°C |
| storage temp. | Refrigerator |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 0.52±0.10(Predicted) |
| color | Off-White to Beige |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. Corrosive-causes burns. |
| BRN | 1897287 |
| Henry's Law Constant | 4.3×10-2 mol/(m3Pa) at 25℃, Arp et al. (2006) |
| InChI | InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28) |
| InChIKey | UZUFPBIDKMEQEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 375-95-1(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorononanoic acid (375-95-1) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P201-P260-P263-P301+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 |
| Hazardous Substances Data | 375-95-1(Hazardous Substances Data) |