36809-75-3
| Name | TIN(IV) TERT-BUTOXIDE |
| CAS | 36809-75-3 |
| EINECS(EC#) | -0 |
| Molecular Formula | C16H36O4Sn |
| MDL Number | MFCD00156551 |
| Molecular Weight | 411.16 |
| MOL File | 36809-75-3.mol |
Chemical Properties
| Appearance | solid |
| Melting point | 40-44 °C(lit.) |
| Boiling point | 65°C 0,3mm |
| density | 1,06 g/cm3 |
| Fp | 65°C/0.3mm |
| form | liquid |
| color | white solid to turbid colorless |
| Stability: | Stable. Incompatible with oxidizing agents. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/4C4H9O.Sn/c4*1-4(2,3)5;/h4*1-3H3;/q4*-1;+4 |
| InChIKey | OSXGKVOYAKRLCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Sn](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3146 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2905190098 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |