7488-55-3
| Name | Stannous sulfate |
| CAS | 7488-55-3 |
| EINECS(EC#) | 231-302-2 |
| Molecular Formula | O4SSn |
| MDL Number | MFCD00011246 |
| Molecular Weight | 214.77 |
| MOL File | 7488-55-3.mol |
Chemical Properties
| Appearance | off-white solid |
| Melting point | 360 °C |
| bulk density | 800kg/m3 |
| density | 4,15 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 0-6°C |
| form | Solid |
| color | White to off-white |
| Specific Gravity | 1.35 |
| Odor | Odorless |
| PH | 1.6 (50g/l, H2O, 20℃) |
| Stability: | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| Water Solubility | 330 g/L (20 ºC) |
| Merck | 14,8790 |
| Exposure limits | ACGIH: TWA 2 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 2 mg/m3 |
| InChI | 1S/H2O4S.Sn/c1-5(2,3)4;/h(H2,1,2,3,4);/q;+2/p-2 |
| InChIKey | OBBXFSIWZVFYJR-UHFFFAOYSA-L |
| SMILES | [SnH2++].[O-]S([O-])(=O)=O |
| CAS DataBase Reference | 7488-55-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |     GHS05,GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H290-H315-H317-H319-H332-H335-H341-H373-H410 |
| Precautionary statements | P273-P280-P302+P352-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3260 8/PG 3 |
| WGK Germany | - |
| RTECS | WT1255000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 28332990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 1 Eye Irrit. 2 Met. Corr. 1 Muta. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 STOT SE 3 |
| Toxicity |