
32779-36-5
| Name | 5-Bromo-2-chloropyrimidine |
| CAS | 32779-36-5 |
| EINECS(EC#) | 629-214-8 |
| Molecular Formula | C4H2BrClN2 |
| MDL Number | MFCD00483232 |
| Molecular Weight | 193.43 |
| MOL File | 32779-36-5.mol |
Chemical Properties
| Appearance | Off-white to beige crystalline powder |
| Melting point | 73-79 °C (lit.) |
| Boiling point | 95°C 15mm |
| density | 1.859±0.06 g/cm3(Predicted) |
| Fp | 95°C/15mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | -2.84±0.22(Predicted) |
| color | Off-white to beige |
| Water Solubility | insoluble |
| Detection Methods | HPLC,NMR |
| BRN | 507955 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H2BrClN2/c5-3-1-7-4(6)8-2-3/h1-2H |
| InChIKey | XPGIBDJXEVAVTO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Br)C=N1 |
| CAS DataBase Reference | 32779-36-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29335900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
