
321-30-2
| Name | 1H-Purin-6-amine sulfate |
| CAS | 321-30-2 |
| EINECS(EC#) | 206-286-5 |
| Molecular Formula | C10H12N10O4S |
| MDL Number | MFCD00213655 |
| Molecular Weight | 368.33 |
| MOL File | 321-30-2.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 285 °C (dec.)(lit.) |
| storage temp. | Store at RT. |
| solubility | 0.5 M HCl: 10 mg/mL |
| form | powder |
| color | White to slightly yellow |
| biological source | synthetic (organic) |
| Water Solubility | 0.4 g/100 mL |
| Sensitive | Hygroscopic |
| Merck | 14,152 |
| BRN | 3820263 |
| Stability: | Hygroscopic |
| Major Application | agriculture |
| InChI | InChI=1S/2C5H5N5.H2O4S/c2*6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h2*1-2H,(H3,6,7,8,9,10);(H2,1,2,3,4) |
| InChIKey | LQXHSCOPYJCOMD-UHFFFAOYSA-N |
| SMILES | C12N=CN=C(N)C=1NC=N2.C12N=CN=C(N)C=1NC=N2.S(=O)(=O)(O)O |
| CAS DataBase Reference | 321-30-2(CAS DataBase Reference) |
| EPA Substance Registry System | 321-30-2(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | AU7140000 |
| F | 8 |
| TSCA | Yes |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
