28961-43-5
| Name | Ethoxylated trimethylolpropane triacrylate |
| CAS | 28961-43-5 |
| EINECS(EC#) | 500-066-5 |
| Molecular Formula | C21H32O9 |
| MDL Number | MFCD00676977 |
| Molecular Weight | 1176 |
| MOL File | 28961-43-5.mol |
Chemical Properties
| Boiling point | 157 °C(lit.) |
| density | 1.12 g/mL at 25 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Fp | >230 °F |
| form | Liquid |
| color | Colorless to light yellow |
| Water Solubility | 880mg/L at 20℃ |
| Cosmetics Ingredients Functions | SKIN CONDITIONING BINDING FILM FORMING |
| InChI | InChI=1S/C21H32O9/c1-5-18(22)28-12-9-25-15-21(8-4,16-26-10-13-29-19(23)6-2)17-27-11-14-30-20(24)7-3/h5-7H,1-3,8-17H2,4H3 |
| InChIKey | MTPIZGPBYCHTGQ-UHFFFAOYSA-N |
| SMILES | C(CC)(COCCOC(=O)C=C)(COCCOC(=O)C=C)COCCOC(=O)C=C |
| LogP | 2.89 at 23℃ |
| EPA Substance Registry System | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-[(1oxo-2-propenyl)oxy]-, ether with 2-ethyl-2-(hydroxymethyl)1,3-propanediol (3:1)(28961-43-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319-H412 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Skin Sens. 1 |
| Toxicity |