
262423-77-8
| Name | 2,4-Dichloropyridine-3-carboxylic acid |
| CAS | 262423-77-8 |
| Molecular Formula | C6H3Cl2NO2 |
| MDL Number | MFCD06796292 |
| Molecular Weight | 192 |
| MOL File | 262423-77-8.mol |
Chemical Properties
| Melting point | 166-167° |
| Boiling point | 325.2±37.0 °C(Predicted) |
| density | 1.612±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 0.79±0.25(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H3Cl2NO2/c7-3-1-2-9-5(8)4(3)6(10)11/h1-2H,(H,10,11) |
| InChIKey | ZFGZNVSNOJPGDV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1C(O)=O |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
