26201-32-1
| Name | Titanyl phthalocyanine |
| CAS | 26201-32-1 |
| EINECS(EC#) | 419-970-5 |
| Molecular Formula | C32H16N8OTi |
| MDL Number | MFCD00145414 |
| Molecular Weight | 576.39 |
| MOL File | 26201-32-1.mol |
Chemical Properties
| Melting point | 395.1 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder (Blue) |
| color | Dark red to Dark purple to Dark blue |
| λmax | 700 nm |
| InChIKey | SJHHDDDGXWOYOE-UHFFFAOYSA-N |
| SMILES | N12[Ti](=O)N3C4N=C5C6C=CC=CC=6C(=N5)N=C1C1C=CC=CC=1C2=NC1=NC(C2C=CC=CC1=2)=NC3=C1C=4C=CC=C1 |c:17,28,40,t:5| |
| CAS DataBase Reference | 26201-32-1(CAS DataBase Reference) |
| EPA Substance Registry System | 26201-32-1(EPA Substance) |
| Absorption | λmax?= 692 nm (chlorobenzene) |
| Odor | Dark purple powder/crystals |
| solubility | Chlorobenzene [7] |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | No |
| REACH Registrations | Active |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |