2620-44-2
| Name | 1,2-(Methylenedioxy)-4-nitrobenzene |
| CAS | 2620-44-2 |
| EINECS(EC#) | 220-055-6 |
| Molecular Formula | C7H5NO4 |
| MDL Number | MFCD00005824 |
| Molecular Weight | 167.12 |
| MOL File | 2620-44-2.mol |
Chemical Properties
| Appearance | yellow fine crystalline powder |
| Melting point | 146-148 °C (lit.) |
| Boiling point | 295.67°C (rough estimate) |
| density | 1.5216 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| Fp | 289 °F |
| storage temp. | Store at room temperature |
| solubility | acetone: soluble2.5%, clear to slightly hazy, yellow |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| BRN | 169063 |
| InChI | 1S/C7H5NO4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2 |
| InChIKey | SNWQAKNKGGOVMO-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2OCOc2c1 |
| CAS DataBase Reference | 2620-44-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Benzodioxole, 5-nitro-(2620-44-2) |
| EPA Substance Registry System | 2620-44-2(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
