
2613-26-5
| Name | 3-NITROPHENYLSULFUR PENTAFLUORIDE |
| CAS | 2613-26-5 |
| EINECS(EC#) | 447-600-2 |
| Molecular Formula | C6H4F5NO2S |
| MDL Number | MFCD00221621 |
| Molecular Weight | 249.16 |
| MOL File | 2613-26-5.mol |
Chemical Properties
| Melting point | 0℃ |
| Boiling point | 106 °C2 mm Hg(lit.) |
| density | 1.665 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Difficult to mix in water. |
| BRN | 2699206 |
| InChI | InChI=1S/C6H4F5NO2S/c7-15(8,9,10,11)6-3-1-2-5(4-6)12(13)14/h1-4H |
| InChIKey | FSTNQYCPXJMFMT-UHFFFAOYSA-N |
| SMILES | S(C1C=CC=C(N(=O)=O)C=1)(F)(F)(F)(F)F |
| CAS DataBase Reference | 2613-26-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H301+H311+H331-H315-H301-H311-H331-H302-H319-H332-H335 |
| Precautionary statements | P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501-P301+P310a-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| TSCA | No |
| REACH Registrations | Inactive |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 STOT SE 3 |

