26042-64-8
| Name | Silver hexafluoroantimonate |
| CAS | 26042-64-8 |
| EINECS(EC#) | 247-429-1 |
| Molecular Formula | Ag2F6Si |
| MDL Number | MFCD00046162 |
| Molecular Weight | 357.81 |
| MOL File | 26042-64-8.mol |
Chemical Properties
| Appearance | white to pale yellow crystalline powder |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | sol (and forms 1:2 complexes with) benzene, toluene, xylene; sol nitromethane, liq SO2; insol HF, petroleum ether. |
| form | Powder/Lump |
| color | White to pale yellow |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Detection Methods | Assay Argentometry |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| Stability: | hygroscopic |
| Major Application | PEM fuel cells material synthesis precursor |
| InChI | InChI=1S/Ag.6FH.Sb/h;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | GSXFODUDOAXUBF-UHFFFAOYSA-H |
| SMILES | [Sb+5]([F-])([F-])([F-])([F-])([F-])[F-].[Ag+] |
| CAS DataBase Reference | 26042-64-8(CAS DataBase Reference) |
| EPA Substance Registry System | Antimonate(1-), hexafluoro-, silver(1+), (OC-6-11)- (26042-64-8) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H411 |
| Precautionary statements | P273-P301+P312+P330-P304+P340+P312 |
| Hazard Codes | Xn,N,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 2 |
| F | 3-8-10 |
| Hazard Note | Corrosive/Hygroscopic |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 28432900 |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 |