25152-85-6
| Name | cis-3-Hexenyl benzoate |
| CAS | 25152-85-6 |
| EINECS(EC#) | 246-669-4 |
| Molecular Formula | C13H16O2 |
| MDL Number | MFCD00036526 |
| Molecular Weight | 204.26 |
| MOL File | 25152-85-6.mol |
Chemical Properties
| Boiling point | 105 °C1 mm Hg(lit.) |
| density | 0.999 g/mL at 25 °C(lit.) |
| vapor pressure | 0.45Pa at 24℃ |
| FEMA | 3688 |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Odor | at 100.00 %. fresh green leafy floral orchid balsamic fatty |
| biological source | synthetic |
| Odor Type | green |
| Water Solubility | 40.3mg/L at 24℃ |
| JECFA Number | 858 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H16O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h3-7,9-10H,2,8,11H2,1H3/b4-3- |
| InChIKey | BCOXBEHFBZOJJZ-ARJAWSKDSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)c1ccccc1 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | DH1442500 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29163100 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |