2495-35-4
| Name | Benzyl acrylate |
| CAS | 2495-35-4 |
| EINECS(EC#) | 219-673-9 |
| Molecular Formula | C10H10O2 |
| MDL Number | MFCD00048147 |
| Molecular Weight | 162.19 |
| MOL File | 2495-35-4.mol |
Chemical Properties
| Melting point | 214-216 °C |
| Boiling point | 110-111°C 8mm |
| density | 1,08 g/cm3 |
| vapor pressure | 11.2Pa at 25℃ |
| refractive index | 1.5180 |
| Fp | 111°C/8mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colorless |
| Water Solubility | Miscible with organic solvents and water. |
| InChI | InChI=1S/C10H10O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h2-7H,1,8H2 |
| InChIKey | GCTPMLUUWLLESL-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)C=C |
| LogP | 2.436 |
| CAS DataBase Reference | 2495-35-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2495-35-4(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H335-H411 |
| Precautionary statements | P261-P264-P271-P273-P280-P302+P352 |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3082 |
| WGK Germany | WGK 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Irrit. 2 STOT SE 3 |