2315-97-1
| Name | LUCIGENIN |
| CAS | 2315-97-1 |
| EINECS(EC#) | 219-023-4 |
| Molecular Formula | C28H22N4O6 |
| MDL Number | MFCD00011925 |
| Molecular Weight | 510.5 |
| MOL File | 2315-97-1.mol |
Chemical Properties
| Melting point | 250°C |
| storage temp. | room temp |
| solubility | acetic acid: soluble10mg/mL |
| form | powder |
| color | Yellow powder with orange to brown cast |
| λmax | 455nm |
| BRN | 3901768 |
| Biological Applications | Chloride indicator; diagnosis of hemostatic disorders; detecting bacteria,nucleicacids,proteins,pathogens; identifying respiratory infections; generating and detecting reactive oxygen species; chemiluminescent indicator |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C28H22N2.2NO3/c1-29-23-15-7-3-11-19(23)27(20-12-4-8-16-24(20)29)28-21-13-5-9-17-25(21)30(2)26-18-10-6-14-22(26)28;2*2-1(3)4/h3-18H,1-2H3;;/q+2;2*-1 |
| InChIKey | KNJDBYZZKAZQNG-UHFFFAOYSA-N |
| SMILES | C1(=C2C=CC=CC2=[N+](C)C2=CC=CC=C12)C1=C2C=CC=CC2=[N+](C)C2=CC=CC=C12.[N+]([O-])([O-])=O.[N+]([O-])([O-])=O |
Safety Data
| Symbol(GHS) |   GHS03,GHS07 |
| Signal word | Warning |
| Hazard statements | H272-H315-H319 |
| Precautionary statements | P210-P220-P221-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Safety Statements | |
| RIDADR | 1479 |
| WGK Germany | 3 |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |