2215-77-2
| Name | 4-PHENOXYBENZOIC ACID |
| CAS | 2215-77-2 |
| EINECS(EC#) | 218-682-5 |
| Molecular Formula | C13H10O3 |
| MDL Number | MFCD00002539 |
| Molecular Weight | 214.22 |
| MOL File | 2215-77-2.mol |
Chemical Properties
| Appearance | white to slightly yellow crystalline powder |
| Melting point | 163-165 °C (lit.) |
| Boiling point | 314.35°C (rough estimate) |
| density | 1.1956 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Very faint turbidity in hot methanol. |
| form | Crystalline Powder |
| pka | 4.57(at 25℃) |
| color | White to slightly yellow |
| Sensitive | Air Sensitive |
| BRN | 2212463 |
| InChI | 1S/C13H10O3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H,(H,14,15) |
| InChIKey | RYAQFHLUEMJOMF-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Oc2ccccc2)cc1 |
| CAS DataBase Reference | 2215-77-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-phenoxy-(2215-77-2) |
| EPA Substance Registry System | 2215-77-2(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DH6293620 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |