22080-96-2
| Name | 4-Hydroxy-2,6-dimethoxybenzaldehyde |
| CAS | 22080-96-2 |
| EINECS(EC#) | 200-110-4 |
| Molecular Formula | C9H10O4 |
| MDL Number | MFCD01407645 |
| Molecular Weight | 182.17 |
| MOL File | 22080-96-2.mol |
Chemical Properties
| Melting point | 225 °C (dec.)(lit.) |
| Boiling point | 370.4±37.0 °C(Predicted) |
| density | 1.234±0.06 g/cm3(Predicted) |
| storage temp. | Keep Cold |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.04±0.23(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H10O4/c1-12-8-3-6(11)4-9(13-2)7(8)5-10/h3-5,11H,1-2H3 |
| InChIKey | HZWPJAZIRZFCGX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(OC)C=C(O)C=C1OC |
| CAS DataBase Reference | 22080-96-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29125000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |