2203-97-6
| Name | Hydrocortisone 21-hemisuccinate |
| CAS | 2203-97-6 |
| EINECS(EC#) | 218-612-3 |
| Molecular Formula | C25H34O8 |
| MDL Number | MFCD00046256 |
| Molecular Weight | 462.53 |
| MOL File | 2203-97-6.mol |
Chemical Properties
| Appearance | White or almost white, hygroscopic powder |
| Melting point | 170～172℃ |
| alpha | [α]D20 +147～+153° (c=1, C2H5OH) (After Drying) |
| Boiling point | 685.5±55.0 °C(Predicted) |
| density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Practically insoluble in water, freely soluble in acetone and in anhydrous ethanol. It dissolves in dilute solutions of alkali carbonates and alkali hydroxides. |
| form | neat |
| pka | pKa 5.10/5.64(20% aq EtOH/50% aq EtOH) (Uncertain) |
| color | White to Off-White |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | VWQWXZAWFPZJDA-CGVGKPPMSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@H]3[C@@H]4CC[C@](O)(C(=O)COC(=O)CCC(O)=O)[C@@]4(C)C[C@H](O)[C@H]23 |