20570-96-1
| Name | BENZYLHYDRAZINE DIHYDROCHLORIDE |
| CAS | 20570-96-1 |
| EINECS(EC#) | 243-887-1 |
| Molecular Formula | C7H12Cl2N2 |
| MDL Number | MFCD00012921 |
| Molecular Weight | 195.09 |
| MOL File | 20570-96-1.mol |
Chemical Properties
| Appearance | slightly yellow to beige powder |
| Melting point | 143-145 °C (dec.)(lit.) |
| Boiling point | 149.5℃ at 95.5kPa |
| density | 0.628g/cm3 at 23℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | Slightly yellow to beige |
| Water Solubility | Insoluble in water. |
| BRN | 3688990 |
| InChI | InChI=1S/C7H10N2.2ClH/c8-9-6-7-4-2-1-3-5-7;;/h1-5,9H,6,8H2;2*1H |
| InChIKey | MSJHOJKVMMEMNX-UHFFFAOYSA-N |
| SMILES | N(CC1=CC=CC=C1)N.[H]Cl.[H]Cl |
| Dissociation constant | 0.001-0.001 at 23℃ |
| CAS DataBase Reference | 20570-96-1(CAS DataBase Reference) |
| Storage Precautions | Store under inert gas |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MU8540000 |
| F | 10 |
| TSCA | Yes |
| REACH Registrations | Inactive |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29280000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |