19777-66-3
| Name | (S)-(-)-1,2-Diaminopropane dihydrochloride |
| CAS | 19777-66-3 |
| Molecular Formula | C3H12Cl2N2 |
| MDL Number | MFCD01862631 |
| Molecular Weight | 147.05 |
| MOL File | 19777-66-3.mol |
Chemical Properties
| Melting point | 238-243 °C |
| alpha | -4 º (c=20 in H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| Optical Rotation | [α]22/D 4°, c = 20 in H2O |
| BRN | 5740936 |
| InChI | InChI=1/C3H10N2.ClH/c1-3(5)2-4;/h3H,2,4-5H2,1H3;1H/t3-;/s3 |
| InChIKey | AEIAMRMQKCPGJR-QTNFYWBSSA-N |
| SMILES | [C@H](N)(C)CN.Cl |&1:0,r| |
| CAS DataBase Reference | 19777-66-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| REACH Registrations | Active |
| HS Code | 29212900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |