1941-26-0
| Name | Tetraethylammonium nitrate |
| CAS | 1941-26-0 |
| EINECS(EC#) | 217-725-5 |
| Molecular Formula | C8H20N2O3 |
| MDL Number | MFCD00041978 |
| Molecular Weight | 192.26 |
| MOL File | 1941-26-0.mol |
Chemical Properties
| Appearance | white or off-white solid |
| Melting point | ~280 °C (dec.) |
| Boiling point | >100 °C |
| density | 1.029 g/mL at 25 °C |
| refractive index | 1.4450 (estimate) |
| Fp | >100°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| color | White |
| Specific Gravity | 1.029 |
| Stability: | Stable. Incompatible with reducing agents, combustible materials, strong oxidants. Strong oxidizer-contact with combustible material may lead to fire. |
| BRN | 3918466 |
| InChI | 1S/C8H20N.NO3/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | JTJKNAJRGLQKDZ-UHFFFAOYSA-N |
| SMILES | [O-][N+]([O-])=O.CC[N+](CC)(CC)CC |
| EPA Substance Registry System | Ethanaminium, N,N,N-triethyl-, nitrate(1941-26-0) |
Safety Data
| Hazard Codes | Xi,O |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3139 5.1/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |