19335-11-6
| Name | 5-AMINOINDAZOLE |
| CAS | 19335-11-6 |
| EINECS(EC#) | 242-971-5 |
| Molecular Formula | C7H7N3 |
| MDL Number | MFCD00037975 |
| Molecular Weight | 133.15 |
| MOL File | 19335-11-6.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 175-178 °C (lit.) |
| Boiling point | 235.67°C (rough estimate) |
| density | 1.1873 (rough estimate) |
| refractive index | 1.5341 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.52±0.40(Predicted) |
| color | White to Brown |
| Detection Methods | HPLC |
| BRN | 3259 |
| InChI | InChI=1S/C7H7N3/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H,8H2,(H,9,10) |
| InChIKey | XBTOSRUBOXQWBO-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(N)C=C2)C=N1 |
| CAS DataBase Reference | 19335-11-6(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Aminoindazole (19335-11-6) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NK7711000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
