
19094-56-5
| Name | 2-Chloro-5-iodobenzoic acid |
| CAS | 19094-56-5 |
| EINECS(EC#) | 606-224-0 |
| Molecular Formula | C7H4ClIO2 |
| MDL Number | MFCD00079731 |
| Molecular Weight | 282.46 |
| MOL File | 19094-56-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 157-161 °C (lit.) |
| Boiling point | 353.1±27.0 °C(Predicted) |
| density | 2.077±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.53±0.25(Predicted) |
| color | Yellow to light brown crystals or crystalline powder (light sensitive) |
| Sensitive | Light Sensitive |
| BRN | 2254110 |
| InChI | InChI=1S/C7H4ClIO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | GEBYSTBEDVQOTK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(I)=CC=C1Cl |
| CAS DataBase Reference | 19094-56-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T,N,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| PackingGroup | III |
| HS Code | 29163990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Eye Dam. 1 |