18829-55-5
| Name | trans-2-Heptenal |
| CAS | 18829-55-5 |
| EINECS(EC#) | 242-608-0 |
| Molecular Formula | C7H12O |
| MDL Number | MFCD00007010 |
| Molecular Weight | 112.17 |
| MOL File | 18829-55-5.mol |
Chemical Properties
| Appearance | clear colorless to light yellow liquid |
| Melting point | -53.35°C (estimate) |
| Boiling point | 90-91 °C50 mm Hg(lit.) |
| density | 0.857 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| FEMA | 3165 |
| refractive index | n |
| Fp | 128 °F |
| storage temp. | Refrigerator (+4°C) + Flammables area |
| form | neat |
| color | Colorless to Light yellow to Light orange |
| Odor | at 1.00 % in dipropylene glycol. pungent green vegetable fresh fatty |
| biological source | synthetic |
| Odor Type | green |
| JECFA Number | 1360 |
| BRN | 1700822 |
| InChI | 1S/C7H12O/c1-2-3-4-5-6-7-8/h5-7H,2-4H2,1H3/b6-5+ |
| InChIKey | NDFKTBCGKNOHPJ-AATRIKPKSA-N |
| SMILES | [H]C(=O)\C([H])=C(/[H])CCCC |
Safety Data
| Symbol(GHS) |   GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H302+H332-H311-H317 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1988 3/PG 3 |
| WGK Germany | 3 |
| RTECS | MJ8795000 |
| F | 10-23 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29121900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Flam. Liq. 3 Skin Sens. 1 |