
18595-18-1
| Name | Methyl 3-amino-4-methylbenzoate |
| CAS | 18595-18-1 |
| EINECS(EC#) | 606-067-8 |
| Molecular Formula | C9H11NO2 |
| MDL Number | MFCD00025206 |
| Molecular Weight | 165.19 |
| MOL File | 18595-18-1.mol |
Chemical Properties
| Melting point | 113-117 °C(lit.) |
| Boiling point | 296.3±20.0 °C(Predicted) |
| density | 1.132±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 3.31±0.10(Predicted) |
| color | White to cream |
| BRN | 2088611 |
| InChI | InChI=1S/C9H11NO2/c1-6-3-4-7(5-8(6)10)9(11)12-2/h3-5H,10H2,1-2H3 |
| InChIKey | YEPWCJHMSVABPQ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C)C(N)=C1 |
| LogP | 1.7 at 22℃ and pH7 |
| CAS DataBase Reference | 18595-18-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P280-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

