17626-40-3
| Name | 3,4-Diaminobenzonitrile |
| CAS | 17626-40-3 |
| EINECS(EC#) | 629-100-8 |
| Molecular Formula | C7H7N3 |
| MDL Number | MFCD00723901 |
| Molecular Weight | 133.15 |
| MOL File | 17626-40-3.mol |
Chemical Properties
| Appearance | White to light yellow crystal powde |
| Melting point | 144-148 °C |
| Boiling point | 368.7±27.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in dichloromethane, methanol and ethyl acetate. |
| form | Solid |
| pka | 2.35±0.10(Predicted) |
| color | Pale brown |
| Usage | A synthetic intermediat |
| λmax | 316nm(THF)(lit.) |
| Stability: | Store in freezer at -20°C |
| InChI | InChI=1S/C7H7N3/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,9-10H2 |
| InChIKey | VWLLPPSBBHDXHK-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N)C(N)=C1 |
| CAS DataBase Reference | 17626-40-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
