
6393-40-4
| Name | 4-Amino-3-nitrobenzonitrile |
| CAS | 6393-40-4 |
| Molecular Formula | C7H5N3O2 |
| MDL Number | MFCD00013373 |
| Molecular Weight | 163.13 |
| MOL File | 6393-40-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 159-162 °C (lit.) |
| Boiling point | 349.8±32.0 °C(Predicted) |
| density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in ethanol and benzene. |
| form | Powder, Crystals or Crystalline Powder |
| pka | -3.52±0.10(Predicted) |
| color | Yellow |
| Usage | Gamma irradiations effect on release of 4-amino-3-nitrobenzonitrile from polyanhydride matrixes. |
| BRN | 778939 |
| InChI | InChI=1S/C7H5N3O2/c8-4-5-1-2-6(9)7(3-5)10(11)12/h1-3H,9H2 |
| InChIKey | JAHADAZIDZMHOP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 6393-40-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
