1693-74-9
| Name | TETRAHYDROFURAN-D8 |
| CAS | 1693-74-9 |
| EINECS(EC#) | 216-898-4 |
| Molecular Formula | C4D8O |
| MDL Number | MFCD00044238 |
| Molecular Weight | 80.16 |
| MOL File | 1693-74-9.mol |
Chemical Properties
| Appearance | colourless liquid with an ether-like odour |
| Melting point | −106 °C(lit.) |
| Boiling point | 65-66 °C(lit.) |
| density | 0.985 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 1 °F |
| storage temp. | Refrigerator (+4°C) |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 0.99 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents, strong bases, oxygen. May generate peroxides in storage if in contact with air. Highly flammable. Store under nitrogen. Hazardous polymerisation may occur. |
| Water Solubility | Soluble in water. |
| BRN | 111854 |
| InChI | 1S/C4H8O/c1-2-4-5-3-1/h1-4H2/i1D2,2D2,3D2,4D2 |
| InChIKey | WYURNTSHIVDZCO-SVYQBANQSA-N |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| CAS DataBase Reference | 1693-74-9(CAS DataBase Reference) |
| EPA Substance Registry System | Furan-2,3,4,5-d4, tetrahydro-d4- (1693-74-9) |
Safety Data
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H319-H335-H351 |
| Precautionary statements | P201-P210-P305+P351+P338-P308+P313 |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2056 3/PG 2 |
| WGK Germany | 3 |
| RTECS | LU5950000 |
| Autoignition Temperature | 215 °C |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| Toxicity |