16873-13-5
| Name | Tetraethylammonium hydrogensulfate |
| CAS | 16873-13-5 |
| EINECS(EC#) | 240-899-9 |
| Molecular Formula | C8H21NO4S |
| MDL Number | MFCD00036150 |
| Molecular Weight | 227.32 |
| MOL File | 16873-13-5.mol |
Chemical Properties
| Appearance | White to off-white powder |
| Melting point | 243-245 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | White to off-white |
| Odor | Odorless |
| Water Solubility | Soluble in water |
| λmax | λ: 210 nm Amax: 0.05 λ: 220 nm Amax: 0.04 λ: 230 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 6590581 |
| InChI | 1S/C8H20N.H2O4S/c1-5-9(6-2,7-3)8-4;1-5(2,3)4/h5-8H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | CREVBWLEPKAZBH-UHFFFAOYSA-M |
| SMILES | OS([O-])(=O)=O.CC[N+](CC)(CC)CC |
| CAS DataBase Reference | 16873-13-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |