16567-18-3
| Name | 8-Bromoquinoline |
| CAS | 16567-18-3 |
| EINECS(EC#) | 630-629-1 |
| Molecular Formula | C9H6BrN |
| MDL Number | MFCD00191859 |
| Molecular Weight | 208.05 |
| MOL File | 16567-18-3.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 58-59 °C |
| Boiling point | 112-113 °C/0.5 mmHg (lit.) |
| density | 1.594 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Refrigerator (+4°C) |
| form | Liquid After Melting |
| pka | 2.33±0.17(Predicted) |
| color | Clear yellow to yellow-brown |
| Specific Gravity | 1.594 |
| Sensitive | Light Sensitive |
| Detection Methods | GC |
| InChI | InChI=1S/C9H6BrN/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-6H |
| InChIKey | PIWNKSHCLTZKSZ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2Br)C=CC=1 |
| CAS DataBase Reference | 16567-18-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 8-bromo-(16567-18-3) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29334900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
