
2005-43-8
| Name | 2-Bromoquinoline |
| CAS | 2005-43-8 |
| EINECS(EC#) | 679-582-9 |
| Molecular Formula | C9H6BrN |
| MDL Number | MFCD00234480 |
| Molecular Weight | 208.05 |
| MOL File | 2005-43-8.mol |
Chemical Properties
| Melting point | 44-48 °C |
| Boiling point | 115°C/0.3mmHg(lit.) |
| density | 1.564±0.06 g/cm3(Predicted) |
| Fp | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 0.58±0.40(Predicted) |
| color | White to Light yellow |
| λmax | 319nm(EtOH)(lit.) |
| Detection Methods | GC |
| InChI | InChI=1S/C9H6BrN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| InChIKey | QKJAZPHKNWSXDF-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=CC=1Br |
| CAS DataBase Reference | 2005-43-8(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen;Heat sensitive |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

