
1638-22-8
| Name | 4-Butylphenol |
| CAS | 1638-22-8 |
| EINECS(EC#) | 216-672-5 |
| Molecular Formula | C10H14O |
| MDL Number | MFCD00041750 |
| Molecular Weight | 150.22 |
| MOL File | 1638-22-8.mol |
Chemical Properties
| Appearance | The butylphenols include several isomers. Solid butylphenols (28805-86-9) generally have properties similar to the above: |
| Melting point | 22°C |
| Boiling point | 138-139°C 18mm |
| density | 0,98 g/cm3 |
| refractive index | 1.5170 |
| Fp | 245°C |
| storage temp. | RT, stored under nitrogen |
| form | clear liquid |
| pka | 10.11±0.13(Predicted) |
| color | Colorless to Brown |
| Water Solubility | Not miscible with water. |
| Usage | Intermediates of Liquid Crystals |
| BRN | 2042120 |
| InChI | InChI=1S/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| InChIKey | CYYZDBDROVLTJU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCCC)C=C1 |
| CAS DataBase Reference | 1638-22-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-butyl-(1638-22-8) |
| EPA Substance Registry System | 1638-22-8(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314-H318 |
| Precautionary statements | P260-P264-P270-P271-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P501a |
| Hazard Codes | C,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3145 |
| WGK Germany | WGK 3 |
| RTECS | SJ8922500 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2907199090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Safety Profile |

