
1612756-29-2
| Name | NAI-N3 |
| CAS | 1612756-29-2 |
| Molecular Formula | C10H8N6O |
| MDL Number | MFCD31560475 |
| Molecular Weight | 228.21 |
| MOL File | 1612756-29-2.mol |
Chemical Properties
| Melting point | 74-80°C |
| storage temp. | Store at -20°C |
| solubility | Ethanol:16.67(Max Conc. mg/mL);73.05(Max Conc. mM) DMSO:250.0(Max Conc. mg/mL);1095.46(Max Conc. mM) |
| form | Solid |
| pka | 2.364±0.10(predicted) |
| color | White to Pale Beige |
| Stability: | Light sensitive, Moisture sensitive |
| InChI | 1S/C10H8N6O/c11-15-14-6-9-8(2-1-3-13-9)10(17)16-5-4-12-7-16/h1-5,7H,6H2 |
| InChIKey | QPSQVTFTPHUCEH-UHFFFAOYSA-N |
| SMILES | [N+](=[N-])=NCc1ncccc1C(=O)[n]2cncc2 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H373-H312-H319-H315-H332-H335-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P261-P271-P304+P340-P312-P260-P314-P501-P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P363-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Self-react. C Skin Irrit. 2 |

