15632-39-0
| Name | TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM(III) |
| CAS | 15632-39-0 |
| Molecular Formula | C33H57O6Y |
| MDL Number | MFCD00015713 |
| Molecular Weight | 638.71 |
| MOL File | 15632-39-0.mol |
Chemical Properties
| Appearance | white crystals |
| Melting point | 173-175 °C(lit.) |
| Boiling point | 290°C |
| Fp | 95°C/0.05mm |
| storage temp. | Inert atmosphere,2-8°C |
| form | crystal |
| color | white to off-white |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/3C11H20O2.Y/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-; |
| InChIKey | PPRRRPCEDUWEHL-LWTKGLMZSA-K |
| SMILES | C(C)(C)(C)/C(/O[Y](O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)=C/C(=O)C(C)(C)C |
| CAS DataBase Reference | 15632-39-0 |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |