
15499-84-0
| Name | 4,4'-(9-Fluorenylidene)dianiline |
| CAS | 15499-84-0 |
| EINECS(EC#) | 628-740-5 |
| Molecular Formula | C25H20N2 |
| MDL Number | MFCD00039156 |
| Molecular Weight | 348.44 |
| MOL File | 15499-84-0.mol |
Chemical Properties
| Melting point | 237-239 °C (lit.) |
| Boiling point | 535.2±50.0 °C(Predicted) |
| density | 1.245±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 4.92±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C25H20N2/c26-19-13-9-17(10-14-19)25(18-11-15-20(27)16-12-18)23-7-3-1-5-21(23)22-6-2-4-8-24(22)25/h1-16H,26-27H2 |
| InChIKey | KIFDSGGWDIVQGN-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(N)C=C2)(C2=CC=C(N)C=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 15499-84-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 STOT SE 3 |
