150-38-9
| Name | Ethylenediaminetetraacetic acid trisodium salt solution |
| CAS | 150-38-9 |
| EINECS(EC#) | 205-758-8 |
| Molecular Formula | C10H15N2Na3O9 |
| MDL Number | MFCD00149675 |
| Molecular Weight | 376.2 |
| MOL File | 150-38-9.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 237 °C |
| density | 1.69[at 20℃] |
| vapor pressure | 0.007Pa at 50℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: clear, colorless to light yellow |
| form | Liquid |
| color | White to off-white |
| PH | 8 |
| Stability: | Stable. Incompatible with strong oxidizing agents, copper, aluminium. |
| Water Solubility | 212.9g/L at 20℃ |
| Merck | 13,3545 |
| Cosmetics Ingredients Functions | CHELATING |
| InChI | InChI=1S/C10H16N2O8.3Na.2H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;2*1H2/q;3*+1;;/p-3 |
| InChIKey | OABSPZRQQUFHRY-UHFFFAOYSA-K |
| SMILES | N(CC([O-])=O)(CC(=O)O)CCN(CC([O-])=O)CC([O-])=O.O.O.[Na+].[Na+].[Na+] |
| LogP | -3.8 at 25℃ |
| CAS DataBase Reference | 150-38-9(CAS DataBase Reference) |
| EPA Substance Registry System | Ethylenediaminetetraacetic acid trisodium salt (150-38-9) |
Safety Data
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H318-H373 |
| Precautionary statements | P260-P280-P305+P351+P338-P314-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | AH5250000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 STOT RE 2 Inhalation |
| Safety Profile |