14975-30-5
| Name | H-ARG-NH2 2HCL |
| CAS | 14975-30-5 |
| Molecular Formula | C6H17Cl2N5O |
| MDL Number | MFCD00058286 |
| Molecular Weight | 246.14 |
| MOL File | 14975-30-5.mol |
Chemical Properties
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | white to off-white |
| Optical Rotation | Consistent with structure |
| InChI | 1S/C6H15N5O.ClH/c7-4(5(8)12)2-1-3-11-6(9)10;/h4H,1-3,7H2,(H2,8,12)(H4,9,10,11);1H/t4-;/m0./s1 |
| InChIKey | BPQLYFCEVVKLLX-WCCKRBBISA-N |
| SMILES | Cl.N[C@@H](CCCNC(N)=N)C(N)=O |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H370 |
| Precautionary statements | P260-P264-P270-P301+P312-P308+P311-P405 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| HS Code | 2925290090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral STOT SE 1 |