143782-23-4
| Name | 3-Fluoro-4-methylphenylisothiocyanate |
| CAS | 143782-23-4 |
| EINECS(EC#) | 1592732-453-0 |
| Molecular Formula | C9H3F3N2S |
| MDL Number | MFCD00046799 |
| Molecular Weight | 228.194 |
| MOL File | 143782-23-4.mol |
Chemical Properties
| Melting point | 39.0 to 43.0 °C |
| Boiling point | 331℃ |
| density | 1.31 |
| Fp | 154℃ |
| storage temp. | Inert atmosphere, 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Sparingly), Methanol (Slightly) |
| form | powder to lump |
| color | White to Yellow to Green |
| Stability: | Hygroscopic, Moisture sensitive |
| InChI | InChI=1S/C9H3F3N2S/c10-9(11,12)8-3-7(14-5-15)2-1-6(8)4-13/h1-3H |
| InChIKey | TYXKOMAQTWRDCR-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N=C=S)C=C1C(F)(F)F |
| CAS DataBase Reference | 143782-23-4 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| RIDADR | UN3439 |
| REACH Registrations | Inactive |
| HazardClass | 6.1 |
| HS Code | 2929100090 |
