
1430202-69-9
| Name | (2R,6R)-Hydroxynorketamine |
| CAS | 1430202-69-9 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 |
| MOL File | 1430202-69-9.mol |
Chemical Properties
| storage temp. | 2-8°C |
| solubility | DMF: 5 mg/ml; DMSO: 10 mg/ml; Ethanol: 10 mg/ml; PBS (pH 7.2): 5 mg/ml |
| form | powder |
| color | white to beige |
| Optical Rotation | [α]/D -95 to -115°, c = 1 in H2O |
| Water Solubility | H2O: 25mg/mL, clear |
| InChI | 1S/C12H14ClNO2.ClH/c13-9-5-2-1-4-8(9)12(14)7-3-6-10(15)11(12)16;/h1-2,4-5,10,15H,3,6-7,14H2;1H/t10-,12-;/m1./s1 |
| InChIKey | ZQJVHBJDLMIKJK-MHDYBILJSA-N |
| SMILES | O=C1[C@@](C2=CC=CC=C2Cl)(N)CCC[C@H]1O.Cl |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
