
136112-00-0
| Name | PHENOL:CHLOROFORM:ISOAMYL ALC. 25:24:1 |
| CAS | 136112-00-0 |
| Molecular Formula | C6H6O.C5H12O.CHCl3 |
| MDL Number | MFCD00133763 |
| Molecular Weight | 301.637 |
| MOL File | 136112-00-0.mol |
Chemical Properties
| Appearance | clear yellow solution |
| density | 1.29 g/mL at 20 °C |
| Fp | 79 °C |
| storage temp. | 2-8°C |
| form | Liquid |
| PH | 7.7-8.3(H2O-phase, after extraction with H2O, 1:1) |
| Water Solubility | Soluble in water. |
| λmax | λ: 330 nm Amax: 0.2 λ: 405 nm Amax: 0.1 λ: 510 nm Amax: 0.1 |
| InChI | InChI=1S/C6H6O.C5H12O.CHCl3/c7-6-4-2-1-3-5-6;1-5(2)3-4-6;2-1(3)4/h1-5,7H;5-6H,3-4H2,1-2H3;1H |
| InChIKey | ZYWFEOZQIUMEGL-UHFFFAOYSA-N |
| SMILES | ClC([H])(Cl)Cl.O([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])[H].O([H])C1C([H])=C([H])C([H])=C([H])C=1[H] |
| Absorption | cut-off at 360nm |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HazardClass | 8 |
| HS Code | 29420000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Aquatic Chronic 2 Carc. 2 Eye Dam. 1 Muta. 2 Repr. 2 Skin Corr. 1B STOT RE 1 Oral STOT RE 2 STOT SE 3 |