133745-75-2
| Name | N-Fluorobenzenesulfonimide |
| CAS | 133745-75-2 |
| EINECS(EC#) | -0 |
| Molecular Formula | C12H10FNO4S2 |
| MDL Number | MFCD00144885 |
| Molecular Weight | 315.34 |
| MOL File | 133745-75-2.mol |
Chemical Properties
| Appearance | Off-white to light brown crystalline powder |
| Melting point | 114-116 °C |
| Boiling point | 471.4±28.0 °C(Predicted) |
| density | 1.4466 (estimate) |
| Fp | 110℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Very soluble in acetonitrile, dichloromethane or THF and less soluble in toluene. |
| form | solid |
| pka | -32.45±0.70(Predicted) |
| color | white |
| BRN | 5348902 |
| InChI | InChI=1S/C12H10FNO4S2/c13-14(19(15,16)11-7-3-1-4-8-11)20(17,18)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RLKHFSNWQCZBDC-UHFFFAOYSA-N |
| SMILES | C1(S(N(F)S(C2=CC=CC=C2)(=O)=O)(=O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 133745-75-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,O |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Oxidising Agent |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |