
2927-71-1
| Name | 2,4-Dichloro-5-fluoropyrimidine |
| CAS | 2927-71-1 |
| EINECS(EC#) | 625-810-7 |
| Molecular Formula | C4HCl2FN2 |
| MDL Number | MFCD00233551 |
| Molecular Weight | 166.97 |
| MOL File | 2927-71-1.mol |
Chemical Properties
| Appearance | Yellow to Orange Crystalline Solid |
| Melting point | 37-41 °C (lit.) |
| Boiling point | 80 °C / 16mmHg |
| density | 1.605±0.06 g/cm3(Predicted) |
| Fp | 223 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | Powder or Crystalline Powder or Low Melting Solid |
| pka | -3.96±0.29(Predicted) |
| color | White to pale brown |
| Sensitive | Moisture Sensitive |
| Detection Methods | HPLC,NMR |
| InChI | InChI=1S/C4HCl2FN2/c5-3-2(7)1-8-4(6)9-3/h1H |
| InChIKey | WHPFEQUEHBULBW-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(F)C(Cl)=N1 |
| CAS DataBase Reference | 2927-71-1(CAS DataBase Reference) |
| Storage Precautions | Moisture sensitive |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29335900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B Skin Sens. 1A |