Chemical Properties
| Definition | A highly porous igneous rock, usually containing 67–75% Si O2and 10–20% Al 2 O3, with a glassy texture. Potassium, sodium, and calcium are generally present. Insoluble in water, not attacked by acids. |
| Appearance | Grey-brown granular stones |
| bulk density | about 50g/100 mL |
| storage temp. | Store at room temperature. |
| form | granular |
| color | Grey |
| PH | 7.5 -8.0 |
| Cosmetics Ingredients Functions | VISCOSITY CONTROLLING ABRASIVE BULKING |
| InChIKey | CIWBQSYVNNPZIQ-UHFFFAOYSA-N |
| SMILES | CCC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)F)O)C)C)OC(=O)CC |
| Uses | |
| EPA Substance Registry System | Pumice (1332-09-8) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P |
| Safety Statements | |
| WGK Germany | - |
| TSCA | TSCA listed |
| HS Code | 25131000 |
| Storage Class | 13 - Non Combustible Solids |
