
132958-72-6
| Name | (3R)-(+)-3-(DIMETHYLAMINO)PYRROLIDINE |
| CAS | 132958-72-6 |
| Molecular Formula | C6H14N2 |
| MDL Number | MFCD00191347 |
| Molecular Weight | 114.19 |
| MOL File | 132958-72-6.mol |
Chemical Properties
| Appearance | Colorless to light yellow liqui |
| Boiling point | 166 °C760 mm Hg(lit.) |
| density | 0.899 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 125 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | 9.93±0.10(Predicted) |
| color | Colorless to Light yellow |
| Optical Rotation | [α]20/D +14°, c = 1 in ethanol |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H14N2/c1-8(2)6-3-4-7-5-6/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | AVAWMINJNRAQFS-ZCFIWIBFSA-N |
| SMILES | N1CC[C@@H](N(C)C)C1 |
| CAS DataBase Reference | 132958-72-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |