
130250-54-3
| Name | Ethyl 1-Boc-3-piperidinecarboxylate |
| CAS | 130250-54-3 |
| EINECS(EC#) | 623-370-0 |
| Molecular Formula | C13H23NO4 |
| MDL Number | MFCD04116274 |
| Molecular Weight | 257.33 |
| MOL File | 130250-54-3.mol |
Chemical Properties
| Melting point | 31-35℃ |
| Boiling point | 95℃/0.5mm |
| density | 1.077±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to lump |
| pka | -2.40±0.40(Predicted) |
| color | White to Yellow to Orange |
| Sensitive | Moisture & Light Sensitive |
| BRN | 3614917 |
| InChI | InChI=1S/C13H23NO4/c1-5-17-11(15)10-7-6-8-14(9-10)12(16)18-13(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | YCXCRFGBFZTUSU-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC(C(OCC)=O)C1 |
| CAS DataBase Reference | 130250-54-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |

