1256362-30-7
| Name | RuBi-Nicotine |
| CAS | 1256362-30-7 |
| Molecular Formula | C40H44Cl2N8Ru |
| Molecular Weight | 808.807 |
| MOL File | 1256362-30-7.mol |
Chemical Properties
| storage temp. | Store at -20°C |
| solubility | methanol: 100 mM |
| form | Powder |
| color | deep orange |
| Water Solubility | Soluble to 50 mM in water |
| InChIKey | BQXVYFYPLMVART-ZPFSJBFKSA-L |
| SMILES | [Ru+2]85([NH]9=CC=CC=C9C%10=CC=CC=[NH]%108)([NH]6=CC=CC=C6C7=CC=CC=[NH]75)([NH]3=CC=CC(=C3)[C@H]4N(CCC4)C)[NH]1=CC=CC(=C1)[C@H]2N(CCC2)C.[Cl-].[Cl-] |
Safety Data
| Symbol(GHS) |   GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H411-H310-H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 2 |