
1218-35-5
| Name | Xylometazoline hydrochloride |
| CAS | 1218-35-5 |
| EINECS(EC#) | 214-936-4 |
| Molecular Formula | C16H25ClN2 |
| MDL Number | MFCD00238707 |
| Molecular Weight | 280.84 |
| MOL File | 1218-35-5.mol |
Chemical Properties
| Appearance | White or almost white, crystalline powder. |
| Melting point | 131-133 C |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, in ethanol (96 per cent) and in methanol. |
| form | neat |
| color | Crystals |
| Merck | 14,10086 |
| Major Application | forensics and toxicology veterinary |
| InChI | InChI=1S/C16H24N2.ClH/c1-11-8-13(16(3,4)5)9-12(2)14(11)10-15-17-6-7-18-15;/h8-9H,6-7,10H2,1-5H3,(H,17,18);1H |
| InChIKey | YGWFCQYETHJKNX-UHFFFAOYSA-N |
| SMILES | C(C1NCCN=1)C1C(=CC(C(C)(C)C)=CC=1C)C.Cl |
| CAS DataBase Reference | 1218-35-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1218-35-5(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NJ2390000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity |
