117-18-0
| Name | TECNAZENE |
| CAS | 117-18-0 |
| EINECS(EC#) | 204-178-2 |
| Molecular Formula | C6HCl4NO2 |
| MDL Number | MFCD00007066 |
| Molecular Weight | 260.89 |
| MOL File | 117-18-0.mol |
Chemical Properties
| Appearance | beige fine crystalline powder |
| Melting point | 98-101 °C(lit.) |
| Boiling point | 304 °C(lit.) |
| density | 1.744 g/cm3 (25 ºC) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline |
| color | White to Light yellow to Light orange |
| Water Solubility | 2.087mg/L(20 ºC) |
| BRN | 1973805 |
| Henry's Law Constant | 4.3×10-1 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics environmental flavors and fragrances food and beverages personal care pharmaceutical |
| InChI | 1S/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| InChIKey | XQTLDIFVVHJORV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1c(Cl)c(Cl)cc(Cl)c1Cl |
| EPA Substance Registry System | Tecnazene (117-18-0) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | DC0175000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 117-18-0(Hazardous Substances Data) |
| Toxicity |