
109299-78-7
| Name | 5-Pyrimidinylboronic acid |
| CAS | 109299-78-7 |
| Molecular Formula | C4H5BN2O2 |
| MDL Number | MFCD05864565 |
| Molecular Weight | 123.91 |
| MOL File | 109299-78-7.mol |
Chemical Properties
| Appearance | Off-white powder |
| Melting point | 110-114 °C |
| Boiling point | 334.7±34.0 °C(Predicted) |
| density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in Ether, MeOH, DMSO, THF. |
| form | powder to crystal |
| pka | 5.23±0.10(Predicted) |
| color | White to Orange to Green |
| Detection Methods | HPLC,NMR |
| InChI | InChI=1S/C4H5BN2O2/c8-5(9)4-1-6-3-7-2-4/h1-3,8-9H |
| InChIKey | HZFPPBMKGYINDF-UHFFFAOYSA-N |
| SMILES | B(C1=CN=CN=C1)(O)O |
| CAS DataBase Reference | 109299-78-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29335900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
